About CID 143322905
CID 143322905 (PubChem CID 143322905) has the molecular formula C9H11B
and a molecular weight of 130.00 g/mol.
Molecular Properties
| Compound Name | CID 143322905 |
| PubChem CID | 143322905 |
| Molecular Formula | C9H11B |
| Molecular Weight | 130.00 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | — |
| SMILES | [B]C(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H11B/c1-7-3-5-9(6-4-7)8(2)10/h3-6,8H,1-2H3 |
| InChIKey | MCDCHYJSEXAJAW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.00 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 143322905 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143322905?
The IUPAC name of CID 143322905 (CID 143322905) is not available.
What is the SMILES notation for CID 143322905?
The canonical SMILES for CID 143322905 is [B]C(C)c1ccc(C)cc1.
What is the InChIKey of CID 143322905?
The InChIKey is MCDCHYJSEXAJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11B/c1-7-3-5-9(6-4-7)8(2)10/h3-6,8H,1-2H3.
What are the key properties of CID 143322905?
CID 143322905 has a molecular weight of 130.00 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143322905 is sourced from PubChem (CID 143322905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).