C10H14F2 — CID 169209229
1,1-difluoroethane;1,4-xylene (PubChem CID 169209229) has the molecular formula C10H14F2 and a molecular weight of 172.22 g/mol. Its IUPAC name is 1,1-difluoroethane;1,4-xylene.
| Compound Name | 1,1-difluoroethane;1,4-xylene |
|---|---|
| PubChem CID | 169209229 |
| Molecular Formula | C10H14F2 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1,1-difluoroethane;1,4-xylene |
| SMILES | CC(F)F.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C2H4F2/c1-7-3-5-8(2)6-4-7;1-2(3)4/h3-6H,1-2H3;2H,1H3 |
| InChIKey | YGLCGRNAJBUISB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |