C20H32O3 — CID 88581179
5-hydroxy-5-[4-(1-hydroxy-4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanal (PubChem CID 88581179) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 5-hydroxy-5-[4-(1-hydroxy-4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanal.
| Compound Name | 5-hydroxy-5-[4-(1-hydroxy-4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanal |
|---|---|
| PubChem CID | 88581179 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 5-hydroxy-5-[4-(1-hydroxy-4,4-dimethylpentyl)phenyl]-2,2-dimethylpentanal |
| SMILES | CC(C)(C)CCC(O)c1ccc(C(O)CCC(C)(C)C=O)cc1 |
| InChI | InChI=1S/C20H32O3/c1-19(2,3)12-10-17(22)15-6-8-16(9-7-15)18(23)11-13-20(4,5)14-21/h6-9,14,17-18,22-23H,10-13H2,1-5H3 |
| InChIKey | UHCIIPHWHAKTJO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|