C19H36O4 — CID 59659598
6,10-dihydroxy-2,2,14,14-tetramethylpentadecanedial (PubChem CID 59659598) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is 6,10-dihydroxy-2,2,14,14-tetramethylpentadecanedial.
| Compound Name | 6,10-dihydroxy-2,2,14,14-tetramethylpentadecanedial |
|---|---|
| PubChem CID | 59659598 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 6,10-dihydroxy-2,2,14,14-tetramethylpentadecanedial |
| SMILES | CC(C)(C=O)CCCC(O)CCCC(O)CCCC(C)(C)C=O |
| InChI | InChI=1S/C19H36O4/c1-18(2,14-20)12-6-10-16(22)8-5-9-17(23)11-7-13-19(3,4)15-21/h14-17,22-23H,5-13H2,1-4H3 |
| InChIKey | HQGPNFMJFONBBN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|