C19H36O6 — CID 59659514
6,10-dihydroxy-3,3,13,13-tetramethylpentadecanedioic acid (PubChem CID 59659514) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is 6,10-dihydroxy-3,3,13,13-tetramethylpentadecanedioic acid.
| Compound Name | 6,10-dihydroxy-3,3,13,13-tetramethylpentadecanedioic acid |
|---|---|
| PubChem CID | 59659514 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 6,10-dihydroxy-3,3,13,13-tetramethylpentadecanedioic acid |
| SMILES | CC(C)(CCC(O)CCCC(O)CCC(C)(C)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C19H36O6/c1-18(2,12-16(22)23)10-8-14(20)6-5-7-15(21)9-11-19(3,4)13-17(24)25/h14-15,20-21H,5-13H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | FQBKXSAFAVQHBJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |