C15H28N2O4S — CID 11290511
5-[(4-carboxy-3,3-dimethylbutyl)carbamothioylamino]-3,3-dimethylpentanoic acid (PubChem CID 11290511) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is 5-[(4-carboxy-3,3-dimethylbutyl)carbamothioylamino]-3,3-dimethylpentanoic acid.
| Compound Name | 5-[(4-carboxy-3,3-dimethylbutyl)carbamothioylamino]-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 11290511 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-[(4-carboxy-3,3-dimethylbutyl)carbamothioylamino]-3,3-dimethylpentanoic acid |
| SMILES | CC(C)(CCNC(=S)NCCC(C)(C)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C15H28N2O4S/c1-14(2,9-11(18)19)5-7-16-13(22)17-8-6-15(3,4)10-12(20)21/h5-10H2,1-4H3,(H,18,19)(H,20,21)(H2,16,17,22) |
| InChIKey | OATXIWGGRBWIBE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|