C9H15F3N2O3 — CID 64701489
3-methyl-3-(3,3,3-trifluoropropylcarbamoylamino)butanoic acid (PubChem CID 64701489) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 3-methyl-3-(3,3,3-trifluoropropylcarbamoylamino)butanoic acid.
| Compound Name | 3-methyl-3-(3,3,3-trifluoropropylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 64701489 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-methyl-3-(3,3,3-trifluoropropylcarbamoylamino)butanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O3/c1-8(2,5-6(15)16)14-7(17)13-4-3-9(10,11)12/h3-5H2,1-2H3,(H,15,16)(H2,13,14,17) |
| InChIKey | JJPJUFKESZYPAB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |