C15H32N4O2S2 — CID 11610269
1-(4-hydroxy-3,3-dimethylbutyl)-3-[[(4-hydroxy-3,3-dimethylbutyl)carbamothioylamino]methyl]thiourea (PubChem CID 11610269) has the molecular formula C15H32N4O2S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 1-(4-hydroxy-3,3-dimethylbutyl)-3-[[(4-hydroxy-3,3-dimethylbutyl)carbamothioylamino]methyl]thiourea.
| Compound Name | 1-(4-hydroxy-3,3-dimethylbutyl)-3-[[(4-hydroxy-3,3-dimethylbutyl)carbamothioylamino]methyl]thiourea |
|---|---|
| PubChem CID | 11610269 |
| Molecular Formula | C15H32N4O2S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-(4-hydroxy-3,3-dimethylbutyl)-3-[[(4-hydroxy-3,3-dimethylbutyl)carbamothioylamino]methyl]thiourea |
| SMILES | CC(C)(CO)CCNC(=S)NCNC(=S)NCCC(C)(C)CO |
| InChI | InChI=1S/C15H32N4O2S2/c1-14(2,9-20)5-7-16-12(22)18-11-19-13(23)17-8-6-15(3,4)10-21/h20-21H,5-11H2,1-4H3,(H2,16,18,22)(H2,17,19,23) |
| InChIKey | BZIGXQLMSZDEOO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|