C16H35NO2 — CID 11572614
6-[(6-hydroxy-5,5-dimethylhexyl)amino]-2,2-dimethylhexan-1-ol (PubChem CID 11572614) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is 6-[(6-hydroxy-5,5-dimethylhexyl)amino]-2,2-dimethylhexan-1-ol.
| Compound Name | 6-[(6-hydroxy-5,5-dimethylhexyl)amino]-2,2-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 11572614 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | 6-[(6-hydroxy-5,5-dimethylhexyl)amino]-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCCNCCCCC(C)(C)CO |
| InChI | InChI=1S/C16H35NO2/c1-15(2,13-18)9-5-7-11-17-12-8-6-10-16(3,4)14-19/h17-19H,5-14H2,1-4H3 |
| InChIKey | KRGFJELEKNEBOI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|