C15H32O3 — CID 11470973
6-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylhexan-1-ol (PubChem CID 11470973) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 6-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylhexan-1-ol.
| Compound Name | 6-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 11470973 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 6-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCCOCCCC(C)(C)CO |
| InChI | InChI=1S/C15H32O3/c1-14(2,12-16)8-5-6-10-18-11-7-9-15(3,4)13-17/h16-17H,5-13H2,1-4H3 |
| InChIKey | WQRXBUWMZLKKIM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|