C17H34O4 — CID 22606779
7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptanoic acid (PubChem CID 22606779) has the molecular formula C17H34O4 and a molecular weight of 302.46 g/mol. Its IUPAC name is 7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptanoic acid.
| Compound Name | 7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptanoic acid |
|---|---|
| PubChem CID | 22606779 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptanoic acid |
| SMILES | CC(C)(CO)CCCCOCCCCC(C)(C)CC(=O)O |
| InChI | InChI=1S/C17H34O4/c1-16(2,13-15(19)20)9-5-7-11-21-12-8-6-10-17(3,4)14-18/h18H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | SZDQYCFKJVPZFC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|