C23H42N2O5 — CID 90857776
7-[7-(3-ethyl-5-hydroxy-2-oxo-1H-imidazol-4-yl)-5,5-dimethylheptoxy]-3,3-dimethylheptanoic acid (PubChem CID 90857776) has the molecular formula C23H42N2O5 and a molecular weight of 426.60 g/mol. Its IUPAC name is 7-[7-(3-ethyl-5-hydroxy-2-oxo-1H-imidazol-4-yl)-5,5-dimethylheptoxy]-3,3-dimethylheptanoic acid.
| Compound Name | 7-[7-(3-ethyl-5-hydroxy-2-oxo-1H-imidazol-4-yl)-5,5-dimethylheptoxy]-3,3-dimethylheptanoic acid |
|---|---|
| PubChem CID | 90857776 |
| Molecular Formula | C23H42N2O5 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 7-[7-(3-ethyl-5-hydroxy-2-oxo-1H-imidazol-4-yl)-5,5-dimethylheptoxy]-3,3-dimethylheptanoic acid |
| SMILES | CCn1c(CCC(C)(C)CCCCOCCCCC(C)(C)CC(=O)O)c(O)[nH]c1=O |
| InChI | InChI=1S/C23H42N2O5/c1-6-25-18(20(28)24-21(25)29)11-14-22(2,3)12-7-9-15-30-16-10-8-13-23(4,5)17-19(26)27/h28H,6-17H2,1-5H3,(H,24,29)(H,26,27) |
| InChIKey | AROJLFMCBBWUDW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|