C27H52N2O4 — CID 54283727
1-ethyl-4-hydroxy-3-[8-(10-hydroxy-5,5-dimethyldecoxy)-4,4-dimethyloctyl]imidazol-2-one (PubChem CID 54283727) has the molecular formula C27H52N2O4 and a molecular weight of 468.72 g/mol. Its IUPAC name is 1-ethyl-4-hydroxy-3-[8-(10-hydroxy-5,5-dimethyldecoxy)-4,4-dimethyloctyl]imidazol-2-one.
| Compound Name | 1-ethyl-4-hydroxy-3-[8-(10-hydroxy-5,5-dimethyldecoxy)-4,4-dimethyloctyl]imidazol-2-one |
|---|---|
| PubChem CID | 54283727 |
| Molecular Formula | C27H52N2O4 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.39 |
| IUPAC Name | 1-ethyl-4-hydroxy-3-[8-(10-hydroxy-5,5-dimethyldecoxy)-4,4-dimethyloctyl]imidazol-2-one |
| SMILES | CCn1cc(O)n(CCCC(C)(C)CCCCOCCCCC(C)(C)CCCCCO)c1=O |
| InChI | InChI=1S/C27H52N2O4/c1-6-28-23-24(31)29(25(28)32)19-14-18-27(4,5)17-10-13-22-33-21-12-9-16-26(2,3)15-8-7-11-20-30/h23,30-31H,6-22H2,1-5H3 |
| InChIKey | RSPSFJYJKOJBPY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|