C24H46N2O4 — CID 54078203
1-ethyl-3-[3-ethyl-7-[5-ethyl-5-(hydroxymethyl)heptoxy]heptan-3-yl]-4-hydroxyimidazol-2-one (PubChem CID 54078203) has the molecular formula C24H46N2O4 and a molecular weight of 426.64 g/mol. Its IUPAC name is 1-ethyl-3-[3-ethyl-7-[5-ethyl-5-(hydroxymethyl)heptoxy]heptan-3-yl]-4-hydroxyimidazol-2-one.
| Compound Name | 1-ethyl-3-[3-ethyl-7-[5-ethyl-5-(hydroxymethyl)heptoxy]heptan-3-yl]-4-hydroxyimidazol-2-one |
|---|---|
| PubChem CID | 54078203 |
| Molecular Formula | C24H46N2O4 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 1-ethyl-3-[3-ethyl-7-[5-ethyl-5-(hydroxymethyl)heptoxy]heptan-3-yl]-4-hydroxyimidazol-2-one |
| SMILES | CCn1cc(O)n(C(CC)(CC)CCCCOCCCCC(CC)(CC)CO)c1=O |
| InChI | InChI=1S/C24H46N2O4/c1-6-23(7-2,20-27)15-11-13-17-30-18-14-12-16-24(8-3,9-4)26-21(28)19-25(10-5)22(26)29/h19,27-28H,6-18,20H2,1-5H3 |
| InChIKey | MLEYWVACUGRQME-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|