C21H44O4 — CID 58492091
2-(5-butoxypentyl)-2-(octoxymethyl)propane-1,3-diol (PubChem CID 58492091) has the molecular formula C21H44O4 and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-(5-butoxypentyl)-2-(octoxymethyl)propane-1,3-diol.
| Compound Name | 2-(5-butoxypentyl)-2-(octoxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 58492091 |
| Molecular Formula | C21H44O4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | 2-(5-butoxypentyl)-2-(octoxymethyl)propane-1,3-diol |
| SMILES | CCCCCCCCOCC(CO)(CO)CCCCCOCCCC |
| InChI | InChI=1S/C21H44O4/c1-3-5-7-8-9-12-17-25-20-21(18-22,19-23)14-11-10-13-16-24-15-6-4-2/h22-23H,3-20H2,1-2H3 |
| InChIKey | GMZMINOQBPECEM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|