C25H54N2O2 — CID 58492058
2-(5-butoxypentyl)-N,N,N',N'-tetramethyl-2-(octoxymethyl)propane-1,3-diamine (PubChem CID 58492058) has the molecular formula C25H54N2O2 and a molecular weight of 414.72 g/mol. Its IUPAC name is 2-(5-butoxypentyl)-N,N,N',N'-tetramethyl-2-(octoxymethyl)propane-1,3-diamine.
| Compound Name | 2-(5-butoxypentyl)-N,N,N',N'-tetramethyl-2-(octoxymethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 58492058 |
| Molecular Formula | C25H54N2O2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.42 |
| IUPAC Name | 2-(5-butoxypentyl)-N,N,N',N'-tetramethyl-2-(octoxymethyl)propane-1,3-diamine |
| SMILES | CCCCCCCCOCC(CCCCCOCCCC)(CN(C)C)CN(C)C |
| InChI | InChI=1S/C25H54N2O2/c1-7-9-11-12-13-16-21-29-24-25(22-26(3)4,23-27(5)6)18-15-14-17-20-28-19-10-8-2/h7-24H2,1-6H3 |
| InChIKey | DCSLZEOEZJXOAJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|