C28H52N2O4 — CID 90941065
3-[7-(5,5-diethyl-10-hydroxydecoxy)-3-ethylhept-1-en-3-yl]-1-ethyl-4-hydroxyimidazol-2-one (PubChem CID 90941065) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is 3-[7-(5,5-diethyl-10-hydroxydecoxy)-3-ethylhept-1-en-3-yl]-1-ethyl-4-hydroxyimidazol-2-one.
| Compound Name | 3-[7-(5,5-diethyl-10-hydroxydecoxy)-3-ethylhept-1-en-3-yl]-1-ethyl-4-hydroxyimidazol-2-one |
|---|---|
| PubChem CID | 90941065 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | 3-[7-(5,5-diethyl-10-hydroxydecoxy)-3-ethylhept-1-en-3-yl]-1-ethyl-4-hydroxyimidazol-2-one |
| SMILES | C=CC(CC)(CCCCOCCCCC(CC)(CC)CCCCCO)n1c(O)cn(CC)c1=O |
| InChI | InChI=1S/C28H52N2O4/c1-6-27(7-2,18-12-11-15-21-31)19-13-16-22-34-23-17-14-20-28(8-3,9-4)30-25(32)24-29(10-5)26(30)33/h8,24,31-32H,3,6-7,9-23H2,1-2,4-5H3 |
| InChIKey | HQIYGOHMWWGXLP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|