C24H47O5P — CID 20805195
[7-[5,5-bis(ethenyl)-10-hydroxydecoxy]-3-ethylheptan-3-yl]oxy-methylphosphinic acid (PubChem CID 20805195) has the molecular formula C24H47O5P and a molecular weight of 446.61 g/mol. Its IUPAC name is [7-[5,5-bis(ethenyl)-10-hydroxydecoxy]-3-ethylheptan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [7-[5,5-bis(ethenyl)-10-hydroxydecoxy]-3-ethylheptan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 20805195 |
| Molecular Formula | C24H47O5P |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | [7-[5,5-bis(ethenyl)-10-hydroxydecoxy]-3-ethylheptan-3-yl]oxy-methylphosphinic acid |
| SMILES | C=CC(C=C)(CCCCCO)CCCCOCCCCC(CC)(CC)OP(C)(=O)O |
| InChI | InChI=1S/C24H47O5P/c1-6-23(7-2,17-11-10-14-20-25)18-12-15-21-28-22-16-13-19-24(8-3,9-4)29-30(5,26)27/h6-7,25H,1-2,8-22H2,3-5H3,(H,26,27) |
| InChIKey | OEDOUHAGNSOUGG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|