About [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid
[7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid (PubChem CID 20805256) has the molecular formula C23H49O5P
and a molecular weight of 436.61 g/mol. Its IUPAC name is [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid.
Molecular Properties
| Compound Name | [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid |
| PubChem CID | 20805256 |
| Molecular Formula | C23H49O5P |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid |
| SMILES | CCC(CC)(CCCCO)CCCCOCCCCC(CC)(CC)OP(C)(=O)O |
| InChI | InChI=1S/C23H49O5P/c1-6-22(7-2,16-10-13-19-24)17-11-14-20-27-21-15-12-18-23(8-3,9-4)28-29(5,25)26/h24H,6-21H2,1-5H3,(H,25,26) |
| InChIKey | DXVGSXMZSWAGAU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid?
The IUPAC name of [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid (CID 20805256) is [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid.
What is the SMILES notation for [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid?
The canonical SMILES for [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid is CCC(CC)(CCCCO)CCCCOCCCCC(CC)(CC)OP(C)(=O)O.
What is the InChIKey of [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid?
The InChIKey is DXVGSXMZSWAGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H49O5P/c1-6-22(7-2,16-10-13-19-24)17-11-14-20-27-21-15-12-18-23(8-3,9-4)28-29(5,25)26/h24H,6-21H2,1-5H3,(H,25,26).
What are the key properties of [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid?
[7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid has a molecular weight of 436.61 g/mol, XLogP of 6.70, 20 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid is sourced from PubChem (CID 20805256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).