C23H49O5P — CID 20805256
[7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid (PubChem CID 20805256) has the molecular formula C23H49O5P and a molecular weight of 436.61 g/mol. Its IUPAC name is [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 20805256 |
| Molecular Formula | C23H49O5P |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | [7-(5,5-diethyl-9-hydroxynonoxy)-3-ethylheptan-3-yl]oxy-methylphosphinic acid |
| SMILES | CCC(CC)(CCCCO)CCCCOCCCCC(CC)(CC)OP(C)(=O)O |
| InChI | InChI=1S/C23H49O5P/c1-6-22(7-2,16-10-13-19-24)17-11-14-20-27-21-15-12-18-23(8-3,9-4)28-29(5,25)26/h24H,6-21H2,1-5H3,(H,25,26) |
| InChIKey | DXVGSXMZSWAGAU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|