C23H50O9P2 — CID 22085323
[8-(5,5-diethyl-7-phosphonooxyheptoxy)-4,4-diethyloctyl] dihydrogen phosphate (PubChem CID 22085323) has the molecular formula C23H50O9P2 and a molecular weight of 532.59 g/mol. Its IUPAC name is [8-(5,5-diethyl-7-phosphonooxyheptoxy)-4,4-diethyloctyl] dihydrogen phosphate.
| Compound Name | [8-(5,5-diethyl-7-phosphonooxyheptoxy)-4,4-diethyloctyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22085323 |
| Molecular Formula | C23H50O9P2 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [8-(5,5-diethyl-7-phosphonooxyheptoxy)-4,4-diethyloctyl] dihydrogen phosphate |
| SMILES | CCC(CC)(CCCCOCCCCC(CC)(CC)CCOP(=O)(O)O)CCCOP(=O)(O)O |
| InChI | InChI=1S/C23H50O9P2/c1-5-22(6-2,16-13-20-31-33(24,25)26)14-9-11-18-30-19-12-10-15-23(7-3,8-4)17-21-32-34(27,28)29/h5-21H2,1-4H3,(H2,24,25,26)(H2,27,28,29) |
| InChIKey | WWNVDVQRVRNEQG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|