C21H43O7P — CID 22606858
3,3-diethyl-7-[5-ethyl-5-(phosphonooxymethyl)heptoxy]heptanoic acid (PubChem CID 22606858) has the molecular formula C21H43O7P and a molecular weight of 438.54 g/mol. Its IUPAC name is 3,3-diethyl-7-[5-ethyl-5-(phosphonooxymethyl)heptoxy]heptanoic acid.
| Compound Name | 3,3-diethyl-7-[5-ethyl-5-(phosphonooxymethyl)heptoxy]heptanoic acid |
|---|---|
| PubChem CID | 22606858 |
| Molecular Formula | C21H43O7P |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 3,3-diethyl-7-[5-ethyl-5-(phosphonooxymethyl)heptoxy]heptanoic acid |
| SMILES | CCC(CC)(CCCCOCCCCC(CC)(CC)CC(=O)O)COP(=O)(O)O |
| InChI | InChI=1S/C21H43O7P/c1-5-20(6-2,17-19(22)23)13-9-11-15-27-16-12-10-14-21(7-3,8-4)18-28-29(24,25)26/h5-18H2,1-4H3,(H,22,23)(H2,24,25,26) |
| InChIKey | QJCMIIBMPXSWTR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|