C49H104O10P2 — CID 90799141
[9-(5,5-diethyloctoxy)-5,5-diethylnonyl] dihydrogen phosphate;[8-(5,5-diethyloctoxy)-4,4-diethyloctyl] dihydrogen phosphate (PubChem CID 90799141) has the molecular formula C49H104O10P2 and a molecular weight of 915.31 g/mol. Its IUPAC name is [9-(5,5-diethyloctoxy)-5,5-diethylnonyl] dihydrogen phosphate;[8-(5,5-diethyloctoxy)-4,4-diethyloctyl] dihydrogen phosphate.
| Compound Name | [9-(5,5-diethyloctoxy)-5,5-diethylnonyl] dihydrogen phosphate;[8-(5,5-diethyloctoxy)-4,4-diethyloctyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90799141 |
| Molecular Formula | C49H104O10P2 |
| Molecular Weight | 915.31 g/mol |
| Exact Mass | 914.71 |
| IUPAC Name | [9-(5,5-diethyloctoxy)-5,5-diethylnonyl] dihydrogen phosphate;[8-(5,5-diethyloctoxy)-4,4-diethyloctyl] dihydrogen phosphate |
| SMILES | CCCC(CC)(CC)CCCCOCCCCC(CC)(CC)CCCCOP(=O)(O)O.CCCC(CC)(CC)CCCCOCCCCC(CC)(CC)CCCOP(=O)(O)O |
| InChI | InChI=1S/C25H53O5P.C24H51O5P/c1-6-17-24(7-2,8-3)18-11-14-21-29-22-15-12-19-25(9-4,10-5)20-13-16-23-30-31(26,27)28;1-6-16-23(7-2,8-3)17-11-13-20-28-21-14-12-18-24(9-4,10-5)19-15-22-29-30(25,26)27/h6-23H2,1-5H3,(H2,26,27,28);6-22H2,1-5H3,(H2,25,26,27) |
| InChIKey | KOGXFSLBUMSBHX-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.31 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|