C22H45O7P — CID 22606631
7-(5,5-diethyl-7-phosphonooxyheptoxy)-3,3-diethylheptanoic acid (PubChem CID 22606631) has the molecular formula C22H45O7P and a molecular weight of 452.57 g/mol. Its IUPAC name is 7-(5,5-diethyl-7-phosphonooxyheptoxy)-3,3-diethylheptanoic acid.
| Compound Name | 7-(5,5-diethyl-7-phosphonooxyheptoxy)-3,3-diethylheptanoic acid |
|---|---|
| PubChem CID | 22606631 |
| Molecular Formula | C22H45O7P |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 7-(5,5-diethyl-7-phosphonooxyheptoxy)-3,3-diethylheptanoic acid |
| SMILES | CCC(CC)(CCCCOCCCCC(CC)(CC)CC(=O)O)CCOP(=O)(O)O |
| InChI | InChI=1S/C22H45O7P/c1-5-21(6-2,15-18-29-30(25,26)27)13-9-11-16-28-17-12-10-14-22(7-3,8-4)19-20(23)24/h5-19H2,1-4H3,(H,23,24)(H2,25,26,27) |
| InChIKey | GMLAEOLLZMMFJP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|