C24H51O6P — CID 87842248
[7-(3,5-diethyl-9-hydroxynonoxy)-3,3-diethylheptyl] dihydrogen phosphate (PubChem CID 87842248) has the molecular formula C24H51O6P and a molecular weight of 466.64 g/mol. Its IUPAC name is [7-(3,5-diethyl-9-hydroxynonoxy)-3,3-diethylheptyl] dihydrogen phosphate.
| Compound Name | [7-(3,5-diethyl-9-hydroxynonoxy)-3,3-diethylheptyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87842248 |
| Molecular Formula | C24H51O6P |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | [7-(3,5-diethyl-9-hydroxynonoxy)-3,3-diethylheptyl] dihydrogen phosphate |
| SMILES | CCC(CCCCO)CC(CC)CCOCCCCC(CC)(CC)CCOP(=O)(O)O |
| InChI | InChI=1S/C24H51O6P/c1-5-22(13-9-11-17-25)21-23(6-2)14-19-29-18-12-10-15-24(7-3,8-4)16-20-30-31(26,27)28/h22-23,25H,5-21H2,1-4H3,(H2,26,27,28) |
| InChIKey | PEIQOLVRYASDFN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|