C19H42O9P2 — CID 87842908
[2,4-diethyl-6-(5-ethyl-5-phosphonooxyheptoxy)hexyl] dihydrogen phosphate (PubChem CID 87842908) has the molecular formula C19H42O9P2 and a molecular weight of 476.48 g/mol. Its IUPAC name is [2,4-diethyl-6-(5-ethyl-5-phosphonooxyheptoxy)hexyl] dihydrogen phosphate.
| Compound Name | [2,4-diethyl-6-(5-ethyl-5-phosphonooxyheptoxy)hexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87842908 |
| Molecular Formula | C19H42O9P2 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [2,4-diethyl-6-(5-ethyl-5-phosphonooxyheptoxy)hexyl] dihydrogen phosphate |
| SMILES | CCC(CCOCCCCC(CC)(CC)OP(=O)(O)O)CC(CC)COP(=O)(O)O |
| InChI | InChI=1S/C19H42O9P2/c1-5-17(15-18(6-2)16-27-29(20,21)22)11-14-26-13-10-9-12-19(7-3,8-4)28-30(23,24)25/h17-18H,5-16H2,1-4H3,(H2,20,21,22)(H2,23,24,25) |
| InChIKey | LCKWOKSBRQPMNL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|