C14H34O17P4 — CID 159554898
2-[hydroxy-[2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethoxy]phosphoryl]oxyethyl 2-(phosphonooxymethyl)butyl hydrogen phosphate (PubChem CID 159554898) has the molecular formula C14H34O17P4 and a molecular weight of 598.31 g/mol. Its IUPAC name is 2-[hydroxy-[2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethoxy]phosphoryl]oxyethyl 2-(phosphonooxymethyl)butyl hydrogen phosphate.
| Compound Name | 2-[hydroxy-[2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethoxy]phosphoryl]oxyethyl 2-(phosphonooxymethyl)butyl hydrogen phosphate |
|---|---|
| PubChem CID | 159554898 |
| Molecular Formula | C14H34O17P4 |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-[hydroxy-[2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethoxy]phosphoryl]oxyethyl 2-(phosphonooxymethyl)butyl hydrogen phosphate |
| SMILES | CCC(CO)COP(=O)(O)OCCOP(=O)(O)OCCOP(=O)(O)OCC(CC)COP(=O)(O)O |
| InChI | InChI=1S/C14H34O17P4/c1-3-13(9-15)10-30-34(21,22)27-7-5-25-33(19,20)26-6-8-28-35(23,24)31-12-14(4-2)11-29-32(16,17)18/h13-15H,3-12H2,1-2H3,(H,19,20)(H,21,22)(H,23,24)(H2,16,17,18) |
| InChIKey | NTSGMFBZGOVMIU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 254.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|