C10H25NO5P+ — CID 123755404
2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 123755404) has the molecular formula C10H25NO5P+ and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 123755404 |
| Molecular Formula | C10H25NO5P+ |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[hydroxy-[2-(hydroxymethyl)butoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC(CO)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C10H24NO5P/c1-5-10(8-12)9-16-17(13,14)15-7-6-11(2,3)4/h10,12H,5-9H2,1-4H3/p+1 |
| InChIKey | LLODIBNDYARDBF-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|