C56H113NO8P+ — CID 176967702
2-[2,3-bis[(3,7,11-triethyl-15-methylheptadecanoyl)oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 176967702) has the molecular formula C56H113NO8P+ and a molecular weight of 959.49 g/mol. Its IUPAC name is 2-[2,3-bis[(3,7,11-triethyl-15-methylheptadecanoyl)oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,3-bis[(3,7,11-triethyl-15-methylheptadecanoyl)oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 176967702 |
| Molecular Formula | C56H113NO8P+ |
| Molecular Weight | 959.49 g/mol |
| Exact Mass | 958.82 |
| IUPAC Name | 2-[2,3-bis[(3,7,11-triethyl-15-methylheptadecanoyl)oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC(C)CCCC(CC)CCCC(CC)CCCC(CC)CC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC(CC)CCCC(CC)CCCC(CC)CCCC(C)CC |
| InChI | InChI=1S/C56H112NO8P/c1-14-46(9)28-22-30-48(16-3)32-24-34-50(18-5)36-26-38-52(20-7)42-55(58)62-44-54(45-64-66(60,61)63-41-40-57(11,12)13)65-56(59)43-53(21-8)39-27-37-51(19-6)35-25-33-49(17-4)31-23-29-47(10)15-2/h46-54H,14-45H2,1-13H3/p+1 |
| InChIKey | WEHOILXQDAJALB-UHFFFAOYSA-O |
| XLogP | 16.33 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.49 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|