C44H89NO8P+ — CID 22885235
2-[[(2R)-2,3-bis(8-methylheptadecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 22885235) has the molecular formula C44H89NO8P+ and a molecular weight of 791.17 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis(8-methylheptadecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis(8-methylheptadecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 22885235 |
| Molecular Formula | C44H89NO8P+ |
| Molecular Weight | 791.17 g/mol |
| Exact Mass | 790.63 |
| IUPAC Name | 2-[[(2R)-2,3-bis(8-methylheptadecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCC(C)CCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC(C)CCCCCCCCC |
| InChI | InChI=1S/C44H88NO8P/c1-8-10-12-14-16-18-24-30-40(3)32-26-20-22-28-34-43(46)50-38-42(39-52-54(48,49)51-37-36-45(5,6)7)53-44(47)35-29-23-21-27-33-41(4)31-25-19-17-15-13-11-9-2/h40-42H,8-39H2,1-7H3/p+1/t40?,41?,42-/m1/s1 |
| InChIKey | GUTFMRXPPHALFC-SCQKCNBISA-O |
| XLogP | 12.52 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.17 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|