C8H21NO6P+ — CID 54074824
2-[1,2-dihydroxypropoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 54074824) has the molecular formula C8H21NO6P+ and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-[1,2-dihydroxypropoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[1,2-dihydroxypropoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 54074824 |
| Molecular Formula | C8H21NO6P+ |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-[1,2-dihydroxypropoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(O)C(O)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C8H20NO6P/c1-7(10)8(11)15-16(12,13)14-6-5-9(2,3)4/h7-8,10-11H,5-6H2,1-4H3/p+1 |
| InChIKey | MIYGYPHATMLUMR-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|