C14H33NO6P+ — CID 90795347
2-[[(2S)-1,2-dihydroxynonan-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 90795347) has the molecular formula C14H33NO6P+ and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[[(2S)-1,2-dihydroxynonan-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2S)-1,2-dihydroxynonan-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 90795347 |
| Molecular Formula | C14H33NO6P+ |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-[[(2S)-1,2-dihydroxynonan-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCC(OP(=O)(O)OCC[N+](C)(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C14H32NO6P/c1-5-6-7-8-9-14(13(17)12-16)21-22(18,19)20-11-10-15(2,3)4/h13-14,16-17H,5-12H2,1-4H3/p+1/t13-,14?/m0/s1 |
| InChIKey | HWTUSXNZOYUQQP-LSLKUGRBSA-O |
| XLogP | 1.52 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|