C12H29NO8P+ — CID 175227591
2-[2,3-bis(1-hydroxyethoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 175227591) has the molecular formula C12H29NO8P+ and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[2,3-bis(1-hydroxyethoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,3-bis(1-hydroxyethoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 175227591 |
| Molecular Formula | C12H29NO8P+ |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[2,3-bis(1-hydroxyethoxy)propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(C)O |
| InChI | InChI=1S/C12H28NO8P/c1-10(14)18-8-12(21-11(2)15)9-20-22(16,17)19-7-6-13(3,4)5/h10-12,14-15H,6-9H2,1-5H3/p+1 |
| InChIKey | BABHKJYUQXEXRA-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|