C15H33NO8P+ — CID 163563258
2-[hydroxy-[3-methoxy-2-(5-methoxy-5-oxopentoxy)propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 163563258) has the molecular formula C15H33NO8P+ and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[hydroxy-[3-methoxy-2-(5-methoxy-5-oxopentoxy)propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-methoxy-2-(5-methoxy-5-oxopentoxy)propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 163563258 |
| Molecular Formula | C15H33NO8P+ |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[hydroxy-[3-methoxy-2-(5-methoxy-5-oxopentoxy)propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | COCC(COP(=O)(O)OCC[N+](C)(C)C)OCCCCC(=O)OC |
| InChI | InChI=1S/C15H32NO8P/c1-16(2,3)9-11-23-25(18,19)24-13-14(12-20-4)22-10-7-6-8-15(17)21-5/h14H,6-13H2,1-5H3/p+1 |
| InChIKey | FTBKMPKCRPQONE-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|