C15H33NO7P+ — CID 161181353
2-[(3-hexanoyloxy-2-methoxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 161181353) has the molecular formula C15H33NO7P+ and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[(3-hexanoyloxy-2-methoxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(3-hexanoyloxy-2-methoxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 161181353 |
| Molecular Formula | C15H33NO7P+ |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[(3-hexanoyloxy-2-methoxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C15H32NO7P/c1-6-7-8-9-15(17)21-12-14(20-5)13-23-24(18,19)22-11-10-16(2,3)4/h14H,6-13H2,1-5H3/p+1 |
| InChIKey | CXGVBPHJZGYVBA-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|