C20H45NO4P+ — CID 14856205
2-[hydroxy(3,7,11-trimethyldodecoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 14856205) has the molecular formula C20H45NO4P+ and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[hydroxy(3,7,11-trimethyldodecoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy(3,7,11-trimethyldodecoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 14856205 |
| Molecular Formula | C20H45NO4P+ |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-[hydroxy(3,7,11-trimethyldodecoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(C)CCCC(C)CCCC(C)CCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C20H44NO4P/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-16-24-26(22,23)25-17-15-21(5,6)7/h18-20H,8-17H2,1-7H3/p+1 |
| InChIKey | INUZICJGAXXMEY-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|