C45H93O4P — CID 54444487
tris(3,7,11-trimethyldodecyl) phosphate (PubChem CID 54444487) has the molecular formula C45H93O4P and a molecular weight of 729.21 g/mol. Its IUPAC name is tris(3,7,11-trimethyldodecyl) phosphate.
| Compound Name | tris(3,7,11-trimethyldodecyl) phosphate |
|---|---|
| PubChem CID | 54444487 |
| Molecular Formula | C45H93O4P |
| Molecular Weight | 729.21 g/mol |
| Exact Mass | 728.68 |
| IUPAC Name | tris(3,7,11-trimethyldodecyl) phosphate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCOP(=O)(OCCC(C)CCCC(C)CCCC(C)C)OCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C45H93O4P/c1-37(2)19-13-22-40(7)25-16-28-43(10)31-34-47-50(46,48-35-32-44(11)29-17-26-41(8)23-14-20-38(3)4)49-36-33-45(12)30-18-27-42(9)24-15-21-39(5)6/h37-45H,13-36H2,1-12H3 |
| InChIKey | WQNOTPARFFQZGQ-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.21 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|