C16H34Cl2O6P2 — CID 138393309
[dichloro-[hydroxy-[(7S)-3,7,11-trimethyldodecoxy]phosphoryl]methyl]phosphonic acid (PubChem CID 138393309) has the molecular formula C16H34Cl2O6P2 and a molecular weight of 455.30 g/mol. Its IUPAC name is [dichloro-[hydroxy-[(7S)-3,7,11-trimethyldodecoxy]phosphoryl]methyl]phosphonic acid.
| Compound Name | [dichloro-[hydroxy-[(7S)-3,7,11-trimethyldodecoxy]phosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 138393309 |
| Molecular Formula | C16H34Cl2O6P2 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [dichloro-[hydroxy-[(7S)-3,7,11-trimethyldodecoxy]phosphoryl]methyl]phosphonic acid |
| SMILES | CC(C)CCC[C@H](C)CCCC(C)CCOP(=O)(O)C(Cl)(Cl)P(=O)(O)O |
| InChI | InChI=1S/C16H34Cl2O6P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-24-26(22,23)16(17,18)25(19,20)21/h13-15H,5-12H2,1-4H3,(H,22,23)(H2,19,20,21)/t14-,15?/m0/s1 |
| InChIKey | OOWOWPPEZRNINH-MLCCFXAWSA-N |
| XLogP | 6.11 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|