C26H57O10P — CID 175031846
bis(10-methylundecyl) hydrogen phosphate;ethane-1,1,1,2,2,2-hexol (PubChem CID 175031846) has the molecular formula C26H57O10P and a molecular weight of 560.71 g/mol. Its IUPAC name is bis(10-methylundecyl) hydrogen phosphate;ethane-1,1,1,2,2,2-hexol.
| Compound Name | bis(10-methylundecyl) hydrogen phosphate;ethane-1,1,1,2,2,2-hexol |
|---|---|
| PubChem CID | 175031846 |
| Molecular Formula | C26H57O10P |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | bis(10-methylundecyl) hydrogen phosphate;ethane-1,1,1,2,2,2-hexol |
| SMILES | CC(C)CCCCCCCCCOP(=O)(O)OCCCCCCCCCC(C)C.OC(O)(O)C(O)(O)O |
| InChI | InChI=1S/C24H51O4P.C2H6O6/c1-23(2)19-15-11-7-5-9-13-17-21-27-29(25,26)28-22-18-14-10-6-8-12-16-20-24(3)4;3-1(4,5)2(6,7)8/h23-24H,5-22H2,1-4H3,(H,25,26);3-8H |
| InChIKey | CZXSXDKUHMBOKR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|