methyl 6-methylheptyl hydrogen phosphate

C9H21O4P — CID 174422400

IUPACmethyl 6-methylheptyl hydrogen phosphate
SMILESCOP(=O)(O)OCCCCCC(C)C
InChIInChI=1S/C9H21O4P/c1-9(2)7-5-4-6-8-13-14(10,11)12-3/h9H,4-8H2,1-3H3,(H,10,11)
InChIKeyZZROXHRXWMLEGB-UHFFFAOYSA-N
MW224.24 g/mol
LogP2.97
Rot. Bonds8

About methyl 6-methylheptyl hydrogen phosphate

methyl 6-methylheptyl hydrogen phosphate (PubChem CID 174422400) has the molecular formula C9H21O4P and a molecular weight of 224.24 g/mol. Its IUPAC name is methyl 6-methylheptyl hydrogen phosphate.

Molecular Properties

Compound Namemethyl 6-methylheptyl hydrogen phosphate
PubChem CID174422400
Molecular FormulaC9H21O4P
Molecular Weight224.24 g/mol
Exact Mass224.12
IUPAC Namemethyl 6-methylheptyl hydrogen phosphate
SMILESCOP(=O)(O)OCCCCCC(C)C
InChIInChI=1S/C9H21O4P/c1-9(2)7-5-4-6-8-13-14(10,11)12-3/h9H,4-8H2,1-3H3,(H,10,11)
InChIKeyZZROXHRXWMLEGB-UHFFFAOYSA-N
XLogP2.97
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 52.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methyl 6-methylheptyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-methylheptyl hydrogen phosphate?
The IUPAC name of methyl 6-methylheptyl hydrogen phosphate (CID 174422400) is methyl 6-methylheptyl hydrogen phosphate.
What is the SMILES notation for methyl 6-methylheptyl hydrogen phosphate?
The canonical SMILES for methyl 6-methylheptyl hydrogen phosphate is COP(=O)(O)OCCCCCC(C)C.
What is the InChIKey of methyl 6-methylheptyl hydrogen phosphate?
The InChIKey is ZZROXHRXWMLEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O4P/c1-9(2)7-5-4-6-8-13-14(10,11)12-3/h9H,4-8H2,1-3H3,(H,10,11).
What are the key properties of methyl 6-methylheptyl hydrogen phosphate?
methyl 6-methylheptyl hydrogen phosphate has a molecular weight of 224.24 g/mol, XLogP of 2.97, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methylheptyl hydrogen phosphate is sourced from PubChem (CID 174422400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).