C10H25O10P3 — CID 141159700
[hydroxy(8-methylnonoxy)phosphoryl] phosphono hydrogen phosphate (PubChem CID 141159700) has the molecular formula C10H25O10P3 and a molecular weight of 398.22 g/mol. Its IUPAC name is [hydroxy(8-methylnonoxy)phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy(8-methylnonoxy)phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 141159700 |
| Molecular Formula | C10H25O10P3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [hydroxy(8-methylnonoxy)phosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)CCCCCCCOP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H25O10P3/c1-10(2)8-6-4-3-5-7-9-18-22(14,15)20-23(16,17)19-21(11,12)13/h10H,3-9H2,1-2H3,(H,14,15)(H,16,17)(H2,11,12,13) |
| InChIKey | UGMSYTKGCXQGLP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|