About 6-methylheptoxy 6-methylheptyl hydrogen phosphate
6-methylheptoxy 6-methylheptyl hydrogen phosphate (PubChem CID 171569206) has the molecular formula C16H35O5P
and a molecular weight of 338.43 g/mol. Its IUPAC name is 6-methylheptoxy 6-methylheptyl hydrogen phosphate.
Molecular Properties
| Compound Name | 6-methylheptoxy 6-methylheptyl hydrogen phosphate |
| PubChem CID | 171569206 |
| Molecular Formula | C16H35O5P |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 6-methylheptoxy 6-methylheptyl hydrogen phosphate |
| SMILES | CC(C)CCCCCOOP(=O)(O)OCCCCCC(C)C |
| InChI | InChI=1S/C16H35O5P/c1-15(2)11-7-5-9-13-19-21-22(17,18)20-14-10-6-8-12-16(3)4/h15-16H,5-14H2,1-4H3,(H,17,18) |
| InChIKey | HOOPCGGKITVMJL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptoxy 6-methylheptyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptoxy 6-methylheptyl hydrogen phosphate?
The IUPAC name of 6-methylheptoxy 6-methylheptyl hydrogen phosphate (CID 171569206) is 6-methylheptoxy 6-methylheptyl hydrogen phosphate.
What is the SMILES notation for 6-methylheptoxy 6-methylheptyl hydrogen phosphate?
The canonical SMILES for 6-methylheptoxy 6-methylheptyl hydrogen phosphate is CC(C)CCCCCOOP(=O)(O)OCCCCCC(C)C.
What is the InChIKey of 6-methylheptoxy 6-methylheptyl hydrogen phosphate?
The InChIKey is HOOPCGGKITVMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35O5P/c1-15(2)11-7-5-9-13-19-21-22(17,18)20-14-10-6-8-12-16(3)4/h15-16H,5-14H2,1-4H3,(H,17,18).
What are the key properties of 6-methylheptoxy 6-methylheptyl hydrogen phosphate?
6-methylheptoxy 6-methylheptyl hydrogen phosphate has a molecular weight of 338.43 g/mol, XLogP of 5.48, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptoxy 6-methylheptyl hydrogen phosphate is sourced from PubChem (CID 171569206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).