C12H26O — CID 90974533
1-methoxy-4,8-dimethylnonane (PubChem CID 90974533) has the molecular formula C12H26O and a molecular weight of 186.34 g/mol. Its IUPAC name is 1-methoxy-4,8-dimethylnonane.
| Compound Name | 1-methoxy-4,8-dimethylnonane |
|---|---|
| PubChem CID | 90974533 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 1-methoxy-4,8-dimethylnonane |
| SMILES | COCCCC(C)CCCC(C)C |
| InChI | InChI=1S/C12H26O/c1-11(2)7-5-8-12(3)9-6-10-13-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | AMRJURJYWRHUNN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|