C10H22O3 — CID 157079781
1-(2-methoxyethoxymethoxy)-4-methylpentane (PubChem CID 157079781) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethoxy)-4-methylpentane.
| Compound Name | 1-(2-methoxyethoxymethoxy)-4-methylpentane |
|---|---|
| PubChem CID | 157079781 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 1-(2-methoxyethoxymethoxy)-4-methylpentane |
| SMILES | COCCOCOCCCC(C)C |
| InChI | InChI=1S/C10H22O3/c1-10(2)5-4-6-12-9-13-8-7-11-3/h10H,4-9H2,1-3H3 |
| InChIKey | ZHLAQOUQUQJFQN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|