C15H32O5 — CID 158254668
1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-4-methylpentane (PubChem CID 158254668) has the molecular formula C15H32O5 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-4-methylpentane.
| Compound Name | 1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-4-methylpentane |
|---|---|
| PubChem CID | 158254668 |
| Molecular Formula | C15H32O5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-[1,3-bis(2-methoxyethoxy)propan-2-yloxy]-4-methylpentane |
| SMILES | COCCOCC(COCCOC)OCCCC(C)C |
| InChI | InChI=1S/C15H32O5/c1-14(2)6-5-7-20-15(12-18-10-8-16-3)13-19-11-9-17-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | QHEBUZQLIIDCOS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|