C22H52O3 — CID 161045370
methane;1-methoxy-2,5-dimethylhexane;1-(2-methoxyethoxy)-2,5-dimethylhexane (PubChem CID 161045370) has the molecular formula C22H52O3 and a molecular weight of 364.66 g/mol. Its IUPAC name is methane;1-methoxy-2,5-dimethylhexane;1-(2-methoxyethoxy)-2,5-dimethylhexane.
| Compound Name | methane;1-methoxy-2,5-dimethylhexane;1-(2-methoxyethoxy)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 161045370 |
| Molecular Formula | C22H52O3 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.39 |
| IUPAC Name | methane;1-methoxy-2,5-dimethylhexane;1-(2-methoxyethoxy)-2,5-dimethylhexane |
| SMILES | C.C.COCC(C)CCC(C)C.COCCOCC(C)CCC(C)C |
| InChI | InChI=1S/C11H24O2.C9H20O.2CH4/c1-10(2)5-6-11(3)9-13-8-7-12-4;1-8(2)5-6-9(3)7-10-4;;/h10-11H,5-9H2,1-4H3;8-9H,5-7H2,1-4H3;2*1H4 |
| InChIKey | UBKWZUQHJBWIAD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|