C11H24O2 — CID 23636467
(2R)-1-(methoxymethoxy)-2,6-dimethylheptane (PubChem CID 23636467) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (2R)-1-(methoxymethoxy)-2,6-dimethylheptane.
| Compound Name | (2R)-1-(methoxymethoxy)-2,6-dimethylheptane |
|---|---|
| PubChem CID | 23636467 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (2R)-1-(methoxymethoxy)-2,6-dimethylheptane |
| SMILES | COCOC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C11H24O2/c1-10(2)6-5-7-11(3)8-13-9-12-4/h10-11H,5-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | ZYORQDXIKTWYOO-LLVKDONJSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|