C12H26FO2P — CID 574791
1-[ethyl(fluoro)phosphoryl]oxy-3,7-dimethyloctane (PubChem CID 574791) has the molecular formula C12H26FO2P and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-[ethyl(fluoro)phosphoryl]oxy-3,7-dimethyloctane.
| Compound Name | 1-[ethyl(fluoro)phosphoryl]oxy-3,7-dimethyloctane |
|---|---|
| PubChem CID | 574791 |
| Molecular Formula | C12H26FO2P |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-[ethyl(fluoro)phosphoryl]oxy-3,7-dimethyloctane |
| SMILES | CCP(=O)(F)OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C12H26FO2P/c1-5-16(13,14)15-10-9-12(4)8-6-7-11(2)3/h11-12H,5-10H2,1-4H3 |
| InChIKey | IQMVAVDCBMUFQX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|