C24H48O3 — CID 166505156
3,7,11,15-tetramethylhexadecyl 2-hydroxy-2-methylpropanoate (PubChem CID 166505156) has the molecular formula C24H48O3 and a molecular weight of 384.65 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadecyl 2-hydroxy-2-methylpropanoate.
| Compound Name | 3,7,11,15-tetramethylhexadecyl 2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 166505156 |
| Molecular Formula | C24H48O3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.36 |
| IUPAC Name | 3,7,11,15-tetramethylhexadecyl 2-hydroxy-2-methylpropanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOC(=O)C(C)(C)O |
| InChI | InChI=1S/C24H48O3/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-22(5)17-18-27-23(25)24(6,7)26/h19-22,26H,8-18H2,1-7H3 |
| InChIKey | ISTNAHJIJOMMGR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |