C23H48O5SSi — CID 59620737
3,7-dimethyloctyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate (PubChem CID 59620737) has the molecular formula C23H48O5SSi and a molecular weight of 464.79 g/mol. Its IUPAC name is 3,7-dimethyloctyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate.
| Compound Name | 3,7-dimethyloctyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59620737 |
| Molecular Formula | C23H48O5SSi |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 3,7-dimethyloctyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCO[Si](CCCSC(C)(C)C(=O)OCCC(C)CCCC(C)C)(OCC)OCC |
| InChI | InChI=1S/C23H48O5SSi/c1-9-26-30(27-10-2,28-11-3)19-13-18-29-23(7,8)22(24)25-17-16-21(6)15-12-14-20(4)5/h20-21H,9-19H2,1-8H3 |
| InChIKey | YIZWSHJVMAHWJW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|