C30H62O10S2Si2 — CID 59620749
[2-methyl-3-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxypropyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate (PubChem CID 59620749) has the molecular formula C30H62O10S2Si2 and a molecular weight of 703.12 g/mol. Its IUPAC name is [2-methyl-3-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxypropyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate.
| Compound Name | [2-methyl-3-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxypropyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59620749 |
| Molecular Formula | C30H62O10S2Si2 |
| Molecular Weight | 703.12 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | [2-methyl-3-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxypropyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCO[Si](CCCSC(C)(C)C(=O)OCC(C)COC(=O)C(C)(C)SCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C30H62O10S2Si2/c1-12-35-43(36-13-2,37-14-3)22-18-20-41-29(8,9)27(31)33-24-26(7)25-34-28(32)30(10,11)42-21-19-23-44(38-15-4,39-16-5)40-17-6/h26H,12-25H2,1-11H3 |
| InChIKey | PXJZGZWUWCNSTI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.12 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|